C14H18BrClFN — CID 80673133
N-(2-bromoethyl)-N-[(2-chloro-6-fluorophenyl)methyl]cyclopentanamine (PubChem CID 80673133) has the molecular formula C14H18BrClFN and a molecular weight of 334.66 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2-chloro-6-fluorophenyl)methyl]cyclopentanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2-chloro-6-fluorophenyl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 80673133 |
| Molecular Formula | C14H18BrClFN |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2-chloro-6-fluorophenyl)methyl]cyclopentanamine |
| SMILES | Fc1cccc(Cl)c1CN(CCBr)C1CCCC1 |
| InChI | InChI=1S/C14H18BrClFN/c15-8-9-18(11-4-1-2-5-11)10-12-13(16)6-3-7-14(12)17/h3,6-7,11H,1-2,4-5,8-10H2 |
| InChIKey | KJDSGTWSEMRYOE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|