C15H20BrClFN — CID 102620191
N-(2-bromoethyl)-N-[(2-chloro-5-fluorophenyl)methyl]cyclohexanamine (PubChem CID 102620191) has the molecular formula C15H20BrClFN and a molecular weight of 348.69 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2-chloro-5-fluorophenyl)methyl]cyclohexanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2-chloro-5-fluorophenyl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 102620191 |
| Molecular Formula | C15H20BrClFN |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2-chloro-5-fluorophenyl)methyl]cyclohexanamine |
| SMILES | Fc1ccc(Cl)c(CN(CCBr)C2CCCCC2)c1 |
| InChI | InChI=1S/C15H20BrClFN/c16-8-9-19(14-4-2-1-3-5-14)11-12-10-13(18)6-7-15(12)17/h6-7,10,14H,1-5,8-9,11H2 |
| InChIKey | DUOIUTQIEMAROX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|