C14H18BrCl2N — CID 107310031
N-(2-bromoethyl)-N-[(2,3-dichlorophenyl)methyl]cyclopentanamine (PubChem CID 107310031) has the molecular formula C14H18BrCl2N and a molecular weight of 351.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2,3-dichlorophenyl)methyl]cyclopentanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2,3-dichlorophenyl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 107310031 |
| Molecular Formula | C14H18BrCl2N |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2,3-dichlorophenyl)methyl]cyclopentanamine |
| SMILES | Clc1cccc(CN(CCBr)C2CCCC2)c1Cl |
| InChI | InChI=1S/C14H18BrCl2N/c15-8-9-18(12-5-1-2-6-12)10-11-4-3-7-13(16)14(11)17/h3-4,7,12H,1-2,5-6,8-10H2 |
| InChIKey | XHIJEOXMSBFLHZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|