C13H16BrF2N — CID 102860832
N-(2-bromoethyl)-N-[(2,6-difluorophenyl)methyl]cyclobutanamine (PubChem CID 102860832) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2,6-difluorophenyl)methyl]cyclobutanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2,6-difluorophenyl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 102860832 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2,6-difluorophenyl)methyl]cyclobutanamine |
| SMILES | Fc1cccc(F)c1CN(CCBr)C1CCC1 |
| InChI | InChI=1S/C13H16BrF2N/c14-7-8-17(10-3-1-4-10)9-11-12(15)5-2-6-13(11)16/h2,5-6,10H,1,3-4,7-9H2 |
| InChIKey | KWKIWDRIIFIDPP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|