C14H18BrF2N — CID 80672624
N-(2-bromoethyl)-N-[(2,5-difluorophenyl)methyl]cyclopentanamine (PubChem CID 80672624) has the molecular formula C14H18BrF2N and a molecular weight of 318.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2,5-difluorophenyl)methyl]cyclopentanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2,5-difluorophenyl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 80672624 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2,5-difluorophenyl)methyl]cyclopentanamine |
| SMILES | Fc1ccc(F)c(CN(CCBr)C2CCCC2)c1 |
| InChI | InChI=1S/C14H18BrF2N/c15-7-8-18(13-3-1-2-4-13)10-11-9-12(16)5-6-14(11)17/h5-6,9,13H,1-4,7-8,10H2 |
| InChIKey | AVKPIGRYGORKBE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|