C14H19F2N3O — CID 78995782
2-[cyclopentyl-[(2,5-difluorophenyl)methyl]amino]-N'-hydroxyethanimidamide (PubChem CID 78995782) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[cyclopentyl-[(2,5-difluorophenyl)methyl]amino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[cyclopentyl-[(2,5-difluorophenyl)methyl]amino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 78995782 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[cyclopentyl-[(2,5-difluorophenyl)methyl]amino]-N'-hydroxyethanimidamide |
| SMILES | N/C(CN(Cc1cc(F)ccc1F)C1CCCC1)=N/O |
| InChI | InChI=1S/C14H19F2N3O/c15-11-5-6-13(16)10(7-11)8-19(9-14(17)18-20)12-3-1-2-4-12/h5-7,12,20H,1-4,8-9H2,(H2,17,18) |
| InChIKey | HDRVAKBGOVCIBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|