C13H17ClFN3O — CID 54997772
3-[(2-chloro-4-fluorophenyl)methyl-cyclopropylamino]-N'-hydroxypropanimidamide (PubChem CID 54997772) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methyl-cyclopropylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methyl-cyclopropylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54997772 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methyl-cyclopropylamino]-N'-hydroxypropanimidamide |
| SMILES | N/C(CCN(Cc1ccc(F)cc1Cl)C1CC1)=N/O |
| InChI | InChI=1S/C13H17ClFN3O/c14-12-7-10(15)2-1-9(12)8-18(11-3-4-11)6-5-13(16)17-19/h1-2,7,11,19H,3-6,8H2,(H2,16,17) |
| InChIKey | MBBVZGVYDIMZIJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|