C12H14Cl2FN — CID 63387646
N-(2-chloroethyl)-N-[(2-chloro-4-fluorophenyl)methyl]cyclopropanamine (PubChem CID 63387646) has the molecular formula C12H14Cl2FN and a molecular weight of 262.15 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(2-chloro-4-fluorophenyl)methyl]cyclopropanamine.
| Compound Name | N-(2-chloroethyl)-N-[(2-chloro-4-fluorophenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63387646 |
| Molecular Formula | C12H14Cl2FN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | N-(2-chloroethyl)-N-[(2-chloro-4-fluorophenyl)methyl]cyclopropanamine |
| SMILES | Fc1ccc(CN(CCCl)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2FN/c13-5-6-16(11-3-4-11)8-9-1-2-10(15)7-12(9)14/h1-2,7,11H,3-6,8H2 |
| InChIKey | RBORGNXKDSPXSK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|