About 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide
2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide (PubChem CID 77044794) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide |
| PubChem CID | 77044794 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide |
| SMILES | NC(CN(Cc1csc2ccccc12)C1CCCC1)=NO |
| InChI | InChI=1S/C16H21N3OS/c17-16(18-20)10-19(13-5-1-2-6-13)9-12-11-21-15-8-4-3-7-14(12)15/h3-4,7-8,11,13,20H,1-2,5-6,9-10H2,(H2,17,18) |
| InChIKey | UTUQHECVSDRUKK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide (CID 77044794) is 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide is NC(CN(Cc1csc2ccccc12)C1CCCC1)=NO.
What is the InChIKey of 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide?
The InChIKey is UTUQHECVSDRUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c17-16(18-20)10-19(13-5-1-2-6-13)9-12-11-21-15-8-4-3-7-14(12)15/h3-4,7-8,11,13,20H,1-2,5-6,9-10H2,(H2,17,18).
What are the key properties of 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide?
2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide has a molecular weight of 303.43 g/mol, XLogP of 3.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-benzothiophen-3-ylmethyl(cyclopentyl)amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 77044794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).