C13H15BrClF2N — CID 106272497
N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(2-chloroethyl)cyclobutanamine (PubChem CID 106272497) has the molecular formula C13H15BrClF2N and a molecular weight of 338.62 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(2-chloroethyl)cyclobutanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(2-chloroethyl)cyclobutanamine |
|---|---|
| PubChem CID | 106272497 |
| Molecular Formula | C13H15BrClF2N |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(2-chloroethyl)cyclobutanamine |
| SMILES | Fc1ccc(Br)c(F)c1CN(CCCl)C1CCC1 |
| InChI | InChI=1S/C13H15BrClF2N/c14-11-4-5-12(16)10(13(11)17)8-18(7-6-15)9-2-1-3-9/h4-5,9H,1-3,6-8H2 |
| InChIKey | NYVOFBLLFSZMHU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|