C12H14BrF2N — CID 106268507
N-[(3-bromo-2,6-difluorophenyl)methyl]-N-ethylcyclopropanamine (PubChem CID 106268507) has the molecular formula C12H14BrF2N and a molecular weight of 290.15 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-N-ethylcyclopropanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-ethylcyclopropanamine |
|---|---|
| PubChem CID | 106268507 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-ethylcyclopropanamine |
| SMILES | CCN(Cc1c(F)ccc(Br)c1F)C1CC1 |
| InChI | InChI=1S/C12H14BrF2N/c1-2-16(8-3-4-8)7-9-11(14)6-5-10(13)12(9)15/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | KGYZDARFQTZQQG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|