C14H15BrF2N2 — CID 106264001
2-[(3-bromo-2,6-difluorophenyl)methyl-cyclopentylamino]acetonitrile (PubChem CID 106264001) has the molecular formula C14H15BrF2N2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl-cyclopentylamino]acetonitrile.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-cyclopentylamino]acetonitrile |
|---|---|
| PubChem CID | 106264001 |
| Molecular Formula | C14H15BrF2N2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-cyclopentylamino]acetonitrile |
| SMILES | N#CCN(Cc1c(F)ccc(Br)c1F)C1CCCC1 |
| InChI | InChI=1S/C14H15BrF2N2/c15-12-5-6-13(16)11(14(12)17)9-19(8-7-18)10-3-1-2-4-10/h5-6,10H,1-4,8-9H2 |
| InChIKey | YLEQCOHEXOAXIX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|