C15H14BrF2NS — CID 106268675
N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 106268675) has the molecular formula C15H14BrF2NS and a molecular weight of 358.25 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 106268675 |
| Molecular Formula | C15H14BrF2NS |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | Fc1ccc(Br)c(F)c1CN(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H14BrF2NS/c16-13-3-4-14(17)12(15(13)18)8-19(11-1-2-11)7-10-5-6-20-9-10/h3-6,9,11H,1-2,7-8H2 |
| InChIKey | VGCPAJCLRCEVDA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|