C16H15FN2S — CID 103912099
3-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-2-fluorobenzonitrile (PubChem CID 103912099) has the molecular formula C16H15FN2S and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-2-fluorobenzonitrile.
| Compound Name | 3-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103912099 |
| Molecular Formula | C16H15FN2S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(CN(Cc2ccsc2)C2CC2)c1F |
| InChI | InChI=1S/C16H15FN2S/c17-16-13(8-18)2-1-3-14(16)10-19(15-4-5-15)9-12-6-7-20-11-12/h1-3,6-7,11,15H,4-5,9-10H2 |
| InChIKey | DKIBTYRSYVBZBT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |