C16H18N2S2 — CID 61434453
2-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]benzenecarbothioamide (PubChem CID 61434453) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 2-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 2-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 61434453 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[[cyclopropyl(thiophen-3-ylmethyl)amino]methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1CN(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C16H18N2S2/c17-16(19)15-4-2-1-3-13(15)10-18(14-5-6-14)9-12-7-8-20-11-12/h1-4,7-8,11,14H,5-6,9-10H2,(H2,17,19) |
| InChIKey | ZVKLNKXWOPPKPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|