C15H14N2S — CID 61435368
2-[cyclopropyl(thiophen-3-ylmethyl)amino]benzonitrile (PubChem CID 61435368) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-3-ylmethyl)amino]benzonitrile.
| Compound Name | 2-[cyclopropyl(thiophen-3-ylmethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 61435368 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[cyclopropyl(thiophen-3-ylmethyl)amino]benzonitrile |
| SMILES | N#Cc1ccccc1N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H14N2S/c16-9-13-3-1-2-4-15(13)17(14-5-6-14)10-12-7-8-18-11-12/h1-4,7-8,11,14H,5-6,10H2 |
| InChIKey | BRHGLJPSOFICDT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |