C14H15BrN2S — CID 55135535
4-bromo-1-N-cyclopropyl-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine (PubChem CID 55135535) has the molecular formula C14H15BrN2S and a molecular weight of 323.26 g/mol. Its IUPAC name is 4-bromo-1-N-cyclopropyl-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-cyclopropyl-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 55135535 |
| Molecular Formula | C14H15BrN2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-bromo-1-N-cyclopropyl-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C14H15BrN2S/c15-11-1-4-14(13(16)7-11)17(12-2-3-12)8-10-5-6-18-9-10/h1,4-7,9,12H,2-3,8,16H2 |
| InChIKey | ZXAQYPFQOAJSGB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|