C15H16BrN3S — CID 82799106
3-bromo-4-[cyclopropyl(thiophen-3-ylmethyl)amino]benzenecarboximidamide (PubChem CID 82799106) has the molecular formula C15H16BrN3S and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-bromo-4-[cyclopropyl(thiophen-3-ylmethyl)amino]benzenecarboximidamide.
| Compound Name | 3-bromo-4-[cyclopropyl(thiophen-3-ylmethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 82799106 |
| Molecular Formula | C15H16BrN3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 3-bromo-4-[cyclopropyl(thiophen-3-ylmethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(Cc2ccsc2)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrN3S/c16-13-7-11(15(17)18)1-4-14(13)19(12-2-3-12)8-10-5-6-20-9-10/h1,4-7,9,12H,2-3,8H2,(H3,17,18) |
| InChIKey | CRFXQBPIIQHUKA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|