C13H15N5S — CID 80513410
3-[cyclopropyl(thiophen-3-ylmethyl)amino]pyridazine-4-carboximidamide (PubChem CID 80513410) has the molecular formula C13H15N5S and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-[cyclopropyl(thiophen-3-ylmethyl)amino]pyridazine-4-carboximidamide.
| Compound Name | 3-[cyclopropyl(thiophen-3-ylmethyl)amino]pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513410 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[cyclopropyl(thiophen-3-ylmethyl)amino]pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnnc1N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C13H15N5S/c14-12(15)11-3-5-16-17-13(11)18(10-1-2-10)7-9-4-6-19-8-9/h3-6,8,10H,1-2,7H2,(H3,14,15) |
| InChIKey | CUFBEHDSUVVAPU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|