C14H15BrN2O2S2 — CID 61433555
2-amino-4-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)benzenesulfonamide (PubChem CID 61433555) has the molecular formula C14H15BrN2O2S2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 2-amino-4-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61433555 |
| Molecular Formula | C14H15BrN2O2S2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2-amino-4-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)ccc1S(=O)(=O)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C14H15BrN2O2S2/c15-11-1-4-14(13(16)7-11)21(18,19)17(12-2-3-12)8-10-5-6-20-9-10/h1,4-7,9,12H,2-3,8,16H2 |
| InChIKey | LNBCIAFHQLZIPN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|