C13H15N3O2S2 — CID 62158435
6-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 62158435) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62158435 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 6-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(Cc2ccsc2)C2CC2)cn1 |
| InChI | InChI=1S/C13H15N3O2S2/c14-13-4-3-12(7-15-13)20(17,18)16(11-1-2-11)8-10-5-6-19-9-10/h3-7,9,11H,1-2,8H2,(H2,14,15) |
| InChIKey | MRDCOAMXGFROSY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |