C12H12BrNO2S3 — CID 61456293
3-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 61456293) has the molecular formula C12H12BrNO2S3 and a molecular weight of 378.34 g/mol. Its IUPAC name is 3-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61456293 |
| Molecular Formula | C12H12BrNO2S3 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 3-bromo-N-cyclopropyl-N-(thiophen-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1sccc1Br)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C12H12BrNO2S3/c13-11-4-6-18-12(11)19(15,16)14(10-1-2-10)7-9-3-5-17-8-9/h3-6,8,10H,1-2,7H2 |
| InChIKey | DHSAAXACYIJKFB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |