C15H22BrClF2N2 — CID 120835456
N-[(3-bromo-2,6-difluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride (PubChem CID 120835456) has the molecular formula C15H22BrClF2N2 and a molecular weight of 383.71 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120835456 |
| Molecular Formula | C15H22BrClF2N2 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride |
| SMILES | CCCN(Cc1c(F)ccc(Br)c1F)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H21BrF2N2.ClH/c1-2-9-20(11-5-7-19-8-6-11)10-12-14(17)4-3-13(16)15(12)18;/h3-4,11,19H,2,5-10H2,1H3;1H |
| InChIKey | SMGTUBFHIHVLMK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|