C15H23BrClFN2 — CID 119932804
N-[(2-bromo-4-fluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride (PubChem CID 119932804) has the molecular formula C15H23BrClFN2 and a molecular weight of 365.72 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119932804 |
| Molecular Formula | C15H23BrClFN2 |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methyl]-N-propylpiperidin-4-amine;hydrochloride |
| SMILES | CCCN(Cc1ccc(F)cc1Br)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H22BrFN2.ClH/c1-2-9-19(14-5-7-18-8-6-14)11-12-3-4-13(17)10-15(12)16;/h3-4,10,14,18H,2,5-9,11H2,1H3;1H |
| InChIKey | XOWDHCCOEXBARA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |