C14H17FN2 — CID 62048932
2-[cyclopentyl-[(2-fluorophenyl)methyl]amino]acetonitrile (PubChem CID 62048932) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[cyclopentyl-[(2-fluorophenyl)methyl]amino]acetonitrile.
| Compound Name | 2-[cyclopentyl-[(2-fluorophenyl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 62048932 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-[cyclopentyl-[(2-fluorophenyl)methyl]amino]acetonitrile |
| SMILES | N#CCN(Cc1ccccc1F)C1CCCC1 |
| InChI | InChI=1S/C14H17FN2/c15-14-8-4-1-5-12(14)11-17(10-9-16)13-6-2-3-7-13/h1,4-5,8,13H,2-3,6-7,10-11H2 |
| InChIKey | LKEULQLRBPJETG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|