C16H22FN — CID 112828716
N-(cyclopentylmethyl)-N-[(2-fluorophenyl)methyl]cyclopropanamine (PubChem CID 112828716) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-N-[(2-fluorophenyl)methyl]cyclopropanamine.
| Compound Name | N-(cyclopentylmethyl)-N-[(2-fluorophenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 112828716 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-(cyclopentylmethyl)-N-[(2-fluorophenyl)methyl]cyclopropanamine |
| SMILES | Fc1ccccc1CN(CC1CCCC1)C1CC1 |
| InChI | InChI=1S/C16H22FN/c17-16-8-4-3-7-14(16)12-18(15-9-10-15)11-13-5-1-2-6-13/h3-4,7-8,13,15H,1-2,5-6,9-12H2 |
| InChIKey | CCBLSTUNVXCTGL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |