C13H19BrF2N2 — CID 114165785
N'-[(3-bromo-2,6-difluorophenyl)methyl]-N,N'-diethylethane-1,2-diamine (PubChem CID 114165785) has the molecular formula C13H19BrF2N2 and a molecular weight of 321.21 g/mol. Its IUPAC name is N'-[(3-bromo-2,6-difluorophenyl)methyl]-N,N'-diethylethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-2,6-difluorophenyl)methyl]-N,N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 114165785 |
| Molecular Formula | C13H19BrF2N2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N'-[(3-bromo-2,6-difluorophenyl)methyl]-N,N'-diethylethane-1,2-diamine |
| SMILES | CCNCCN(CC)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H19BrF2N2/c1-3-17-7-8-18(4-2)9-10-12(15)6-5-11(14)13(10)16/h5-6,17H,3-4,7-9H2,1-2H3 |
| InChIKey | RXDIILWFBXPLED-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|