C13H17BrClF2NO — CID 114263779
N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(2-chloroethoxy)-N-ethylethanamine (PubChem CID 114263779) has the molecular formula C13H17BrClF2NO and a molecular weight of 356.64 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(2-chloroethoxy)-N-ethylethanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(2-chloroethoxy)-N-ethylethanamine |
|---|---|
| PubChem CID | 114263779 |
| Molecular Formula | C13H17BrClF2NO |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(2-chloroethoxy)-N-ethylethanamine |
| SMILES | CCN(CCOCCCl)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H17BrClF2NO/c1-2-18(6-8-19-7-5-15)9-10-12(16)4-3-11(14)13(10)17/h3-4H,2,5-9H2,1H3 |
| InChIKey | SGPISPPDEFBXLT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|