C12H14BrF2NO2 — CID 106264703
2-[(3-bromo-2,6-difluorophenyl)methyl-propylamino]acetic acid (PubChem CID 106264703) has the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl-propylamino]acetic acid.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 106264703 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H14BrF2NO2/c1-2-5-16(7-11(17)18)6-8-10(14)4-3-9(13)12(8)15/h3-4H,2,5-7H2,1H3,(H,17,18) |
| InChIKey | AYTQAZNXVKFOBV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|