C11H11BrFNO4 — CID 55246136
2-[(3-bromo-4-fluorophenyl)methyl-(carboxymethyl)amino]acetic acid (PubChem CID 55246136) has the molecular formula C11H11BrFNO4 and a molecular weight of 320.11 g/mol. Its IUPAC name is 2-[(3-bromo-4-fluorophenyl)methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[(3-bromo-4-fluorophenyl)methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 55246136 |
| Molecular Formula | C11H11BrFNO4 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-[(3-bromo-4-fluorophenyl)methyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO4/c12-8-3-7(1-2-9(8)13)4-14(5-10(15)16)6-11(17)18/h1-3H,4-6H2,(H,15,16)(H,17,18) |
| InChIKey | WTRIVCLQFWAPAY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |