C11H10BrF2NO4 — CID 114165830
2-[(3-bromo-2,6-difluorophenyl)methyl-(carboxymethyl)amino]acetic acid (PubChem CID 114165830) has the molecular formula C11H10BrF2NO4 and a molecular weight of 338.10 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 114165830 |
| Molecular Formula | C11H10BrF2NO4 |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H10BrF2NO4/c12-7-1-2-8(13)6(11(7)14)3-15(4-9(16)17)5-10(18)19/h1-2H,3-5H2,(H,16,17)(H,18,19) |
| InChIKey | UAWIEARYGOHKQZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|