C14H18BrF2NO2 — CID 106264697
4-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]butanoic acid (PubChem CID 106264697) has the molecular formula C14H18BrF2NO2 and a molecular weight of 350.20 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 106264697 |
| Molecular Formula | C14H18BrF2NO2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H18BrF2NO2/c1-9(2)18(7-3-4-13(19)20)8-10-12(16)6-5-11(15)14(10)17/h5-6,9H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | DBHQLPAFEZHSRM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|