C13H18BrF2N3 — CID 106264204
3-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]propanimidamide (PubChem CID 106264204) has the molecular formula C13H18BrF2N3 and a molecular weight of 334.21 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]propanimidamide.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]propanimidamide |
|---|---|
| PubChem CID | 106264204 |
| Molecular Formula | C13H18BrF2N3 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl-propan-2-ylamino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(Cc1c(F)ccc(Br)c1F)C(C)C |
| InChI | InChI=1S/C13H18BrF2N3/c1-8(2)19(6-5-12(17)18)7-9-11(15)4-3-10(14)13(9)16/h3-4,8H,5-7H2,1-2H3,(H3,17,18) |
| InChIKey | ZWDKFZZUMDILKD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|