C12H16BrF2N3O — CID 106264185
3-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]-N'-hydroxybutanimidamide (PubChem CID 106264185) has the molecular formula C12H16BrF2N3O and a molecular weight of 336.18 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 106264185 |
| Molecular Formula | C12H16BrF2N3O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]-N'-hydroxybutanimidamide |
| SMILES | CC(C/C(N)=N/O)N(C)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H16BrF2N3O/c1-7(5-11(16)17-19)18(2)6-8-10(14)4-3-9(13)12(8)15/h3-4,7,19H,5-6H2,1-2H3,(H2,16,17) |
| InChIKey | MAICSZUZCVHAGX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|