C15H13BrF2N2S — CID 106264042
2-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]benzenecarbothioamide (PubChem CID 106264042) has the molecular formula C15H13BrF2N2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]benzenecarbothioamide.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106264042 |
| Molecular Formula | C15H13BrF2N2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl-methylamino]benzenecarbothioamide |
| SMILES | CN(Cc1c(F)ccc(Br)c1F)c1ccccc1C(N)=S |
| InChI | InChI=1S/C15H13BrF2N2S/c1-20(13-5-3-2-4-9(13)15(19)21)8-10-12(17)7-6-11(16)14(10)18/h2-7H,8H2,1H3,(H2,19,21) |
| InChIKey | PSPFSWVIOXBEAX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|