C16H17BrF2N2 — CID 106264357
2-N-[(3-bromo-2,6-difluorophenyl)methyl]-2-N-propylbenzene-1,2-diamine (PubChem CID 106264357) has the molecular formula C16H17BrF2N2 and a molecular weight of 355.23 g/mol. Its IUPAC name is 2-N-[(3-bromo-2,6-difluorophenyl)methyl]-2-N-propylbenzene-1,2-diamine.
| Compound Name | 2-N-[(3-bromo-2,6-difluorophenyl)methyl]-2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 106264357 |
| Molecular Formula | C16H17BrF2N2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-N-[(3-bromo-2,6-difluorophenyl)methyl]-2-N-propylbenzene-1,2-diamine |
| SMILES | CCCN(Cc1c(F)ccc(Br)c1F)c1ccccc1N |
| InChI | InChI=1S/C16H17BrF2N2/c1-2-9-21(15-6-4-3-5-14(15)20)10-11-13(18)8-7-12(17)16(11)19/h3-8H,2,9-10,20H2,1H3 |
| InChIKey | IWWVIDUPRQJGET-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|