C16H18Cl2N2 — CID 63533670
2-N-[(2,4-dichlorophenyl)methyl]-2-N-propylbenzene-1,2-diamine (PubChem CID 63533670) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-N-[(2,4-dichlorophenyl)methyl]-2-N-propylbenzene-1,2-diamine.
| Compound Name | 2-N-[(2,4-dichlorophenyl)methyl]-2-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63533670 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-N-[(2,4-dichlorophenyl)methyl]-2-N-propylbenzene-1,2-diamine |
| SMILES | CCCN(Cc1ccc(Cl)cc1Cl)c1ccccc1N |
| InChI | InChI=1S/C16H18Cl2N2/c1-2-9-20(16-6-4-3-5-15(16)19)11-12-7-8-13(17)10-14(12)18/h3-8,10H,2,9,11,19H2,1H3 |
| InChIKey | CZRAAZFMUHTORU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|