C11H11BrF2O2 — CID 106273954
4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid (PubChem CID 106273954) has the molecular formula C11H11BrF2O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 106273954 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid |
| SMILES | CC(CCc1c(F)ccc(Br)c1F)C(=O)O |
| InChI | InChI=1S/C11H11BrF2O2/c1-6(11(15)16)2-3-7-9(13)5-4-8(12)10(7)14/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | YEMNXIAUWIGXRW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|