4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid

C11H11BrF2O2 — CID 106273954

IUPAC4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid
SMILESCC(CCc1c(F)ccc(Br)c1F)C(=O)O
InChIInChI=1S/C11H11BrF2O2/c1-6(11(15)16)2-3-7-9(13)5-4-8(12)10(7)14/h4-6H,2-3H2,1H3,(H,15,16)
InChIKeyYEMNXIAUWIGXRW-UHFFFAOYSA-N
MW293.11 g/mol
LogP3.38
Rot. Bonds4

About 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid

4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid (PubChem CID 106273954) has the molecular formula C11H11BrF2O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid.

Molecular Properties

Compound Name4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid
PubChem CID106273954
Molecular FormulaC11H11BrF2O2
Molecular Weight293.11 g/mol
Exact Mass291.99
IUPAC Name4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid
SMILESCC(CCc1c(F)ccc(Br)c1F)C(=O)O
InChIInChI=1S/C11H11BrF2O2/c1-6(11(15)16)2-3-7-9(13)5-4-8(12)10(7)14/h4-6H,2-3H2,1H3,(H,15,16)
InChIKeyYEMNXIAUWIGXRW-UHFFFAOYSA-N
XLogP3.38
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.11
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid?
The IUPAC name of 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid (CID 106273954) is 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid.
What is the SMILES notation for 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid?
The canonical SMILES for 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid is CC(CCc1c(F)ccc(Br)c1F)C(=O)O.
What is the InChIKey of 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid?
The InChIKey is YEMNXIAUWIGXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2O2/c1-6(11(15)16)2-3-7-9(13)5-4-8(12)10(7)14/h4-6H,2-3H2,1H3,(H,15,16).
What are the key properties of 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid?
4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid has a molecular weight of 293.11 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-2,6-difluorophenyl)-2-methylbutanoic acid is sourced from PubChem (CID 106273954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).