C12H12BrF2NO3S — CID 106262927
2-acetamido-3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 106262927) has the molecular formula C12H12BrF2NO3S and a molecular weight of 368.20 g/mol. Its IUPAC name is 2-acetamido-3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 106262927 |
| Molecular Formula | C12H12BrF2NO3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 2-acetamido-3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSCc1c(F)ccc(Br)c1F)C(=O)O |
| InChI | InChI=1S/C12H12BrF2NO3S/c1-6(17)16-10(12(18)19)5-20-4-7-9(14)3-2-8(13)11(7)15/h2-3,10H,4-5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XCMINLASBTZJOM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|