C9H7BrF2O2S — CID 106262897
2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]acetic acid (PubChem CID 106262897) has the molecular formula C9H7BrF2O2S and a molecular weight of 297.12 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 106262897 |
| Molecular Formula | C9H7BrF2O2S |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H7BrF2O2S/c10-6-1-2-7(11)5(9(6)12)3-15-4-8(13)14/h1-2H,3-4H2,(H,13,14) |
| InChIKey | HPCLIXJLEDRYQI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|