C11H11BrF2O4S — CID 106264100
2-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 106264100) has the molecular formula C11H11BrF2O4S and a molecular weight of 357.17 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106264100 |
| Molecular Formula | C11H11BrF2O4S |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H11BrF2O4S/c1-11(2,10(15)16)19(17,18)5-6-8(13)4-3-7(12)9(6)14/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | ANKOKUGXWYIMEL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|