C13H8BrF3O2S — CID 106272385
1-bromo-2,4-difluoro-3-[(2-fluorophenyl)sulfonylmethyl]benzene (PubChem CID 106272385) has the molecular formula C13H8BrF3O2S and a molecular weight of 365.17 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-3-[(2-fluorophenyl)sulfonylmethyl]benzene.
| Compound Name | 1-bromo-2,4-difluoro-3-[(2-fluorophenyl)sulfonylmethyl]benzene |
|---|---|
| PubChem CID | 106272385 |
| Molecular Formula | C13H8BrF3O2S |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 1-bromo-2,4-difluoro-3-[(2-fluorophenyl)sulfonylmethyl]benzene |
| SMILES | O=S(=O)(Cc1c(F)ccc(Br)c1F)c1ccccc1F |
| InChI | InChI=1S/C13H8BrF3O2S/c14-9-5-6-10(15)8(13(9)17)7-20(18,19)12-4-2-1-3-11(12)16/h1-6H,7H2 |
| InChIKey | QNMRQWGURWIDTN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|