C13H9BrClF2NO2S — CID 106273406
4-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-3-chloroaniline (PubChem CID 106273406) has the molecular formula C13H9BrClF2NO2S and a molecular weight of 396.64 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-3-chloroaniline.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-3-chloroaniline |
|---|---|
| PubChem CID | 106273406 |
| Molecular Formula | C13H9BrClF2NO2S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methylsulfonyl]-3-chloroaniline |
| SMILES | Nc1ccc(S(=O)(=O)Cc2c(F)ccc(Br)c2F)c(Cl)c1 |
| InChI | InChI=1S/C13H9BrClF2NO2S/c14-9-2-3-11(16)8(13(9)17)6-21(19,20)12-4-1-7(18)5-10(12)15/h1-5H,6,18H2 |
| InChIKey | IWYNHQBQTHUCML-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|