C10H11BrF2S — CID 106270117
1-bromo-2,4-difluoro-3-(propylsulfanylmethyl)benzene (PubChem CID 106270117) has the molecular formula C10H11BrF2S and a molecular weight of 281.16 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-3-(propylsulfanylmethyl)benzene.
| Compound Name | 1-bromo-2,4-difluoro-3-(propylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 106270117 |
| Molecular Formula | C10H11BrF2S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 1-bromo-2,4-difluoro-3-(propylsulfanylmethyl)benzene |
| SMILES | CCCSCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H11BrF2S/c1-2-5-14-6-7-9(12)4-3-8(11)10(7)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | NXDOXYOVOLTOHE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|