C8H8BrF2N3S — CID 106270613
(3-bromo-2,6-difluorophenyl)methyl N'-aminocarbamimidothioate (PubChem CID 106270613) has the molecular formula C8H8BrF2N3S and a molecular weight of 296.14 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)methyl N'-aminocarbamimidothioate.
| Compound Name | (3-bromo-2,6-difluorophenyl)methyl N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 106270613 |
| Molecular Formula | C8H8BrF2N3S |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)methyl N'-aminocarbamimidothioate |
| SMILES | N/N=C(/N)SCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C8H8BrF2N3S/c9-5-1-2-6(10)4(7(5)11)3-15-8(12)14-13/h1-2H,3,13H2,(H2,12,14) |
| InChIKey | FZUARBGQRZAAES-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|