C11H13BrF2OS — CID 106264831
3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]butan-2-ol (PubChem CID 106264831) has the molecular formula C11H13BrF2OS and a molecular weight of 311.19 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]butan-2-ol.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 106264831 |
| Molecular Formula | C11H13BrF2OS |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]butan-2-ol |
| SMILES | CC(O)C(C)SCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H13BrF2OS/c1-6(15)7(2)16-5-8-10(13)4-3-9(12)11(8)14/h3-4,6-7,15H,5H2,1-2H3 |
| InChIKey | NWIWEVZSBXVUQZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|