C13H17BrF2O2 — CID 114166996
2-[(3-bromo-2,6-difluorophenyl)methyl]-2-propan-2-ylpropane-1,3-diol (PubChem CID 114166996) has the molecular formula C13H17BrF2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-propan-2-ylpropane-1,3-diol.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-propan-2-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 114166996 |
| Molecular Formula | C13H17BrF2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-2-propan-2-ylpropane-1,3-diol |
| SMILES | CC(C)C(CO)(CO)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H17BrF2O2/c1-8(2)13(6-17,7-18)5-9-11(15)4-3-10(14)12(9)16/h3-4,8,17-18H,5-7H2,1-2H3 |
| InChIKey | LOOLCPYROBZZOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|