C15H22BrF2NO — CID 106273662
1-(3-bromo-2,6-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol (PubChem CID 106273662) has the molecular formula C15H22BrF2NO and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
|---|---|
| PubChem CID | 106273662 |
| Molecular Formula | C15H22BrF2NO |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
| SMILES | CC(C)CNCCC(C)(O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H22BrF2NO/c1-10(2)9-19-7-6-15(3,20)8-11-13(17)5-4-12(16)14(11)18/h4-5,10,19-20H,6-9H2,1-3H3 |
| InChIKey | PXNXFJFXQBEWQD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|