C15H23F2NO — CID 66001676
1-(2,4-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol (PubChem CID 66001676) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
|---|---|
| PubChem CID | 66001676 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-methyl-4-(2-methylpropylamino)butan-2-ol |
| SMILES | CC(C)CNCCC(C)(O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H23F2NO/c1-11(2)10-18-7-6-15(3,19)9-12-4-5-13(16)8-14(12)17/h4-5,8,11,18-19H,6-7,9-10H2,1-3H3 |
| InChIKey | SDWKTGIELPXRRB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|