C16H25BrFN — CID 81035051
4-(2-bromo-5-fluorophenyl)-3,3-dimethyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 81035051) has the molecular formula C16H25BrFN and a molecular weight of 330.29 g/mol. Its IUPAC name is 4-(2-bromo-5-fluorophenyl)-3,3-dimethyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 4-(2-bromo-5-fluorophenyl)-3,3-dimethyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 81035051 |
| Molecular Formula | C16H25BrFN |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(2-bromo-5-fluorophenyl)-3,3-dimethyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCC(C)(C)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C16H25BrFN/c1-12(2)11-19-8-7-16(3,4)10-13-9-14(18)5-6-15(13)17/h5-6,9,12,19H,7-8,10-11H2,1-4H3 |
| InChIKey | JWKDGJLMGFVOEX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|